EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H11N5.HCl |
| Net Charge | 0 |
| Average Mass | 249.705 |
| Monoisotopic Mass | 249.07812 |
| SMILES | Cl.Nc1ccc(N=Nc2ccccc2)c(N)n1 |
| InChI | InChI=1S/C11H11N5.ClH/c12-10-7-6-9(11(13)14-10)16-15-8-4-2-1-3-5-8;/h1-7H,(H4,12,13,14);1H |
| InChIKey | QQBPIHBUCMDKFG-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. carcinogenic agent A role played by a chemical compound which is known to induce a process of carcinogenesis by corrupting normal cellular pathways, leading to the acquistion of tumoral capabilities. |
| Applications: | non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. local anaesthetic Any member of a group of drugs that reversibly inhibit the propagation of signals along nerves. Wide variations in potency, stability, toxicity, water-solubility and duration of action determine the route used for administration, e.g. topical, intravenous, epidural or spinal block. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| phenazopyridine hydrochloride (CHEBI:71419) has part phenazopyridine(1+) (CHEBI:71420) |
| phenazopyridine hydrochloride (CHEBI:71419) has role carcinogenic agent (CHEBI:50903) |
| phenazopyridine hydrochloride (CHEBI:71419) has role local anaesthetic (CHEBI:36333) |
| phenazopyridine hydrochloride (CHEBI:71419) has role non-narcotic analgesic (CHEBI:35481) |
| phenazopyridine hydrochloride (CHEBI:71419) is a hydrochloride (CHEBI:36807) |
| IUPAC Name |
|---|
| 3-(phenyldiazenyl)pyridine-2,6-diamine hydrochloride |
| Synonyms | Source |
|---|---|
| 2,6-Diamino-3-phenylazopyridine hydrochloride | ChemIDplus |
| 2,6-Diamino-3-(phenylazo)pyridine monohydrochloride | ChemIDplus |
| 3-Phenylazo-2,6-diaminopyridine hydrochloride | ChemIDplus |
| 3-(Phenylazo)-2,6-pyridinediamine hydrochloride | ChemIDplus |
| Phenazopyridine HCl | ChemIDplus |
| phenazopyridine monohydrochloride | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C19290 | KEGG COMPOUND |
| D05450 | KEGG DRUG |
| DE515781 | Patent |
| Phenazopyridine_hydrochloride | Wikipedia |
| US1680108 | Patent |
| US1680109 | Patent |
| US1680110 | Patent |
| US1680111 | Patent |
| US2008255062 | Patent |
| WO2010038153 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4924060 | Reaxys |
| CAS:136-40-3 | KEGG COMPOUND |
| CAS:136-40-3 | KEGG DRUG |
| CAS:136-40-3 | ChemIDplus |
| Citations |
|---|