EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H11N5 |
| Net Charge | 0 |
| Average Mass | 213.244 |
| Monoisotopic Mass | 213.10145 |
| SMILES | Nc1ccc(N=Nc2ccccc2)c(N)n1 |
| InChI | InChI=1S/C11H11N5/c12-10-7-6-9(11(13)14-10)16-15-8-4-2-1-3-5-8/h1-7H,(H4,12,13,14) |
| InChIKey | QPFYXYFORQJZEC-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. carcinogenic agent A role played by a chemical compound which is known to induce a process of carcinogenesis by corrupting normal cellular pathways, leading to the acquistion of tumoral capabilities. |
| Applications: | non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. local anaesthetic Any member of a group of drugs that reversibly inhibit the propagation of signals along nerves. Wide variations in potency, stability, toxicity, water-solubility and duration of action determine the route used for administration, e.g. topical, intravenous, epidural or spinal block. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| phenazopyridine (CHEBI:71416) has role anticoronaviral agent (CHEBI:149553) |
| phenazopyridine (CHEBI:71416) has role carcinogenic agent (CHEBI:50903) |
| phenazopyridine (CHEBI:71416) has role local anaesthetic (CHEBI:36333) |
| phenazopyridine (CHEBI:71416) has role non-narcotic analgesic (CHEBI:35481) |
| phenazopyridine (CHEBI:71416) is a diaminopyridine (CHEBI:51598) |
| phenazopyridine (CHEBI:71416) is a monoazo compound (CHEBI:48959) |
| phenazopyridine (CHEBI:71416) is conjugate base of phenazopyridine(1+) (CHEBI:71420) |
| Incoming Relation(s) |
| phenazopyridine(1+) (CHEBI:71420) is conjugate acid of phenazopyridine (CHEBI:71416) |
| IUPAC Name |
|---|
| 3-(phenyldiazenyl)pyridine-2,6-diamine |
| INNs | Source |
|---|---|
| fenazopiridina | ChemIDplus |
| phenazopyridine | KEGG DRUG |
| phénazopyridine | WHO MedNet |
| phenazopyridinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 2,6-Diamino-3-phenylazopyridine | ChemIDplus |
| 2,6-Diamino-3-(phenylazo)pyridine | NIST Chemistry WebBook |
| 3-(Phenylazo)-2,6-pyridinediamine | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C07429 | KEGG COMPOUND |
| D08346 | KEGG DRUG |
| DB01438 | DrugBank |
| HMDB0015506 | HMDB |
| LSM-3705 | LINCS |
| Phenazopyridine | Wikipedia |
| US2009247628 | Patent |
| WO2008033466 | Patent |
| WO2010071878 | Patent |
| Citations |
|---|