EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H6N4O5 |
| Net Charge | 0 |
| Average Mass | 238.159 |
| Monoisotopic Mass | 238.03382 |
| SMILES | O=C1CN(/N=C/c2ccc([N+](=O)[O-])o2)C(=O)N1 |
| InChI | InChI=1S/C8H6N4O5/c13-6-4-11(8(14)10-6)9-3-5-1-2-7(17-5)12(15)16/h1-3H,4H2,(H,10,13,14)/b9-3+ |
| InChIKey | NXFQHRVNIOXGAQ-YCRREMRBSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | hepatotoxic agent A role played by a chemical compound exhibiting itself through the ability to induce damage to the liver in animals. antibacterial drug A drug used to treat or prevent bacterial infections. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Applications: | antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. antibacterial drug A drug used to treat or prevent bacterial infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nitrofurantoin (CHEBI:71415) has functional parent semicarbazide (CHEBI:28306) |
| nitrofurantoin (CHEBI:71415) has role antibacterial drug (CHEBI:36047) |
| nitrofurantoin (CHEBI:71415) has role antiinfective agent (CHEBI:35441) |
| nitrofurantoin (CHEBI:71415) has role hepatotoxic agent (CHEBI:50908) |
| nitrofurantoin (CHEBI:71415) is a imidazolidine-2,4-dione (CHEBI:24628) |
| nitrofurantoin (CHEBI:71415) is a nitrofuran antibiotic (CHEBI:87230) |
| nitrofurantoin (CHEBI:71415) is a organonitrogen heterocyclic antibiotic (CHEBI:25558) |
| nitrofurantoin (CHEBI:71415) is a organooxygen heterocyclic antibiotic (CHEBI:25807) |
| IUPAC Name |
|---|
| 1-{[(5-nitro-2-furyl)methylene]amino}imidazolidine-2,4-dione |
| INNs | Source |
|---|---|
| nitrofurantoin | KEGG DRUG |
| nitrofurantoina | ChemIDplus |
| nitrofurantoine | ChemIDplus |
| nitrofurantoinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 1-(5-Nitro-2-furfurylidenamino)hydantoin | ChemIDplus |
| 1-(5-Nitro-2-furfurylideneamino)hydantoin | ChemIDplus |
| 1-((5-Nitrofurfurylidene)amino)hydantoin | ChemIDplus |
| 1-[(5-Nitrofurfurylidene)amino]hydantoin | NIST Chemistry WebBook |
| 5-Nitrofurantoin | NIST Chemistry WebBook |
| N-(5-Nitrofurfurylidene)-1-aminohydantoin | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 1949 | DrugCentral |
| C07268 | KEGG COMPOUND |
| D00439 | KEGG DRUG |
| DB00698 | DrugBank |
| Nitrofurantoin | Wikipedia |
| US2610181 | Patent |
| US2898335 | Patent |
| US2927110 | Patent |
| WO2006019844 | Patent |
| WO2008103673 | Patent |
| WO2010065110 | Patent |
| Citations |
|---|