EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H15N5O10P2 |
| Net Charge | 0 |
| Average Mass | 427.203 |
| Monoisotopic Mass | 427.02941 |
| SMILES | Nc1ncnc2c1nc(=O)n2[C@H]1C[C@H](O)[C@@H](COP(=O)(O)OP(=O)(O)O)O1 |
| InChI | InChI=1S/C10H15N5O10P2/c11-8-7-9(13-3-12-8)15(10(17)14-7)6-1-4(16)5(24-6)2-23-27(21,22)25-26(18,19)20/h3-6,16H,1-2H2,(H,14,17)(H,21,22)(H2,11,12,13)(H2,18,19,20)/t4-,5+,6+/m0/s1 |
| InChIKey | FEPFWQCDWZFLGY-KVQBGUIXSA-N |
| Roles Classification |
|---|
| Biological Role: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 8-oxo-dADP (CHEBI:71397) has functional parent dADP (CHEBI:16174) |
| 8-oxo-dADP (CHEBI:71397) is a purine 2'-deoxyribonucleoside 5'-diphosphate (CHEBI:37036) |
| 8-oxo-dADP (CHEBI:71397) is conjugate acid of 8-oxo-dADP(3−) (CHEBI:71362) |
| 8-oxo-dADP (CHEBI:71397) is tautomer of 8-hydroxy-dADP (CHEBI:70963) |
| Incoming Relation(s) |
| 8-oxo-dADP(3−) (CHEBI:71362) is conjugate base of 8-oxo-dADP (CHEBI:71397) |
| 8-hydroxy-dADP (CHEBI:70963) is tautomer of 8-oxo-dADP (CHEBI:71397) |
| IUPAC Name |
|---|
| 2'-deoxy-8-oxo-8-hydroadenosine 5'-(trihydrogen diphosphate) |
| Synonyms | Source |
|---|---|
| 2'-deoxy-8-oxoadenosine-5'-diphosphate | ChEBI |
| 8-oxo-2'-deoxyadenosine-5'-diphosphate | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 8DD | PDBeChem |
| Citations |
|---|