EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H25MoN8O16P2S2 |
| Net Charge | -1 |
| Average Mass | 843.471 |
| Monoisotopic Mass | 844.93647 |
| SMILES | [H][C@@]12Nc3c(nc(N)nc3=O)N[C@]1([H])O[C@H](COP(=O)(O)OP(=O)(O)OC[C@H]1O[C@@H](n3ccc(N)nc3=O)[C@H](O)[C@@H]1O)C1=C2[S][Mo-](=[O])(=[O])([OH])[S]1 |
| InChI | InChI=1S/C19H26N8O13P2S2.Mo.H2O.2O/c20-7-1-2-27(19(31)22-7)17-11(29)10(28)5(39-17)3-36-41(32,33)40-42(34,35)37-4-6-12(43)13(44)8-16(38-6)24-14-9(23-8)15(30)26-18(21)25-14;;;;/h1-2,5-6,8,10-11,16-17,23,28-29,43-44H,3-4H2,(H,32,33)(H,34,35)(H2,20,22,31)(H4,21,24,25,26,30);;1H2;;/q;+2;;;/p-3/t5-,6-,8+,10-,11-,16-,17-;;;;/m1..../s1 |
| InChIKey | YEBYDVFRFUQMER-MQPNXHJTSA-K |
| Roles Classification |
|---|
| Biological Roles: | Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Mo(VI)-molybdopterin cytosine dinucleotide (CHEBI:71353) is a Mo-molybdopterin cofactor (CHEBI:21437) |
| Mo(VI)-molybdopterin cytosine dinucleotide (CHEBI:71353) is a molybdopterin dinucleotide (CHEBI:37146) |
| Mo(VI)-molybdopterin cytosine dinucleotide (CHEBI:71353) is conjugate acid of Mo(VI)-molybdopterin cytosine dinucleotide(4−) (CHEBI:71308) |
| Incoming Relation(s) |
| Mo(VI)-molybdopterin cytosine dinucleotide(4−) (CHEBI:71308) is conjugate base of Mo(VI)-molybdopterin cytosine dinucleotide (CHEBI:71353) |
| IUPAC Name |
|---|
| {5'-O-[{[{[(5aR,8R,9aR)-2-amino-4-oxo-6,7-bis(sulfanyl-κS)-3,5,5a,8,9a,10-hexahydro-4H-pyrano[3,2-g]pteridin-8-yl]methoxy}(hydroxy)phosphoryl]oxy}(hydroxy)phosphoryl]cytidinato(2−)}(hydroxy)bis(oxido)molybdate(1−) |
| Synonyms | Source |
|---|---|
| cytidylyl molybdenum cofactor | MetaCyc |
| MoO2(OH)Dtpp-mCDP | MetaCyc |
| MoO2OH-molybdopterin cytosine dinucleotide | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| CPD0-1882 | MetaCyc |