EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H50O5 |
| Net Charge | 0 |
| Average Mass | 490.725 |
| Monoisotopic Mass | 490.36582 |
| SMILES | [H][C@]12CC[C@@]34O[C@@H](O)[C@]5([C@H](O)C[C@@]3(C)[C@]1(C)CC[C@@]1([H])C(C)(C)[C@@]([H])(O)CC[C@]21C)[C@@H](O)CC(C)(C)C[C@]54[H] |
| InChI | InChI=1S/C30H50O5/c1-24(2)14-19-29-13-9-18-26(5)11-10-20(31)25(3,4)17(26)8-12-27(18,6)28(29,7)16-22(33)30(19,21(32)15-24)23(34)35-29/h17-23,31-34H,8-16H2,1-7H3/t17-,18+,19-,20-,21-,22+,23+,26-,27+,28-,29-,30-/m0/s1 |
| InChIKey | HUTBSECGWQRLCI-OWYJUUJQSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| anagalligenin A (CHEBI:71347) has parent hydride oleanane (CHEBI:36481) |
| anagalligenin A (CHEBI:71347) has role metabolite (CHEBI:25212) |
| anagalligenin A (CHEBI:71347) is a cyclic ether (CHEBI:37407) |
| anagalligenin A (CHEBI:71347) is a hexacyclic triterpenoid (CHEBI:70994) |
| anagalligenin A (CHEBI:71347) is a lactol (CHEBI:38131) |
| anagalligenin A (CHEBI:71347) is a secondary alcohol (CHEBI:35681) |
| anagalligenin A (CHEBI:71347) is a tetrol (CHEBI:33573) |
| Incoming Relation(s) |
| capilliposide B (CHEBI:65574) has functional parent anagalligenin A (CHEBI:71347) |
| IUPAC Name |
|---|
| (3β,16α,22α)-13,28-epoxyoleanane-3,16,22,28-tetrol |
| Citations |
|---|