EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H25MoN10O16P2S2 |
| Net Charge | -1 |
| Average Mass | 883.496 |
| Monoisotopic Mass | 884.94262 |
| SMILES | [H][C@@]12Nc3c(nc(N)nc3=O)N[C@]1([H])O[C@H](COP(=O)(O)OP(=O)(O)OC[C@H]1O[C@@H](n3cnc4c(=O)nc(N)nc43)[C@H](O)[C@@H]1O)C1=C2[S][Mo-](=[O])(=[O])([OH])[S]1 |
| InChI | InChI=1S/C20H26N10O13P2S2.Mo.H2O.2O/c21-19-26-13-7(15(33)28-19)24-6-12(47)11(46)5(41-17(6)25-13)2-40-45(37,38)43-44(35,36)39-1-4-9(31)10(32)18(42-4)30-3-23-8-14(30)27-20(22)29-16(8)34;;;;/h3-6,9-10,17-18,24,31-32,46-47H,1-2H2,(H,35,36)(H,37,38)(H3,22,27,29,34)(H4,21,25,26,28,33);;1H2;;/q;+2;;;/p-3/t4-,5-,6+,9-,10-,17-,18-;;;;/m1..../s1 |
| InChIKey | BNQXHUPZUCMOJJ-HXAHJUJRSA-K |
| Roles Classification |
|---|
| Biological Roles: | Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Mo(VI)-molybdopterin guanine dinucleotide (CHEBI:71343) is a Mo-molybdopterin cofactor (CHEBI:21437) |
| Mo(VI)-molybdopterin guanine dinucleotide (CHEBI:71343) is a molybdopterin dinucleotide (CHEBI:37146) |
| Mo(VI)-molybdopterin guanine dinucleotide (CHEBI:71343) is conjugate acid of Mo(VI)-molybdopterin guanine dinucleotide(4−) (CHEBI:71310) |
| Incoming Relation(s) |
| Mo(VI)-molybdopterin guanine dinucleotide(4−) (CHEBI:71310) is conjugate base of Mo(VI)-molybdopterin guanine dinucleotide (CHEBI:71343) |
| IUPAC Name |
|---|
| {5'-O-[{[{[(5aR,8R,9aR)-2-amino-4-oxo-6,7-bis(sulfanyl-κS)-3,5,5a,8,9a,10-hexahydro-4H-pyrano[3,2-g]pteridin-8-yl]methoxy}(hydroxy)phosphoryl]oxy}(hydroxy)phosphoryl]guanosinato(2−)}(hydroxy)bis(oxido)molybdate(1−) |
| Synonyms | Source |
|---|---|
| MoO2(OH)-molybdopterin guanine dinucleotide | ChEBI |
| MoO2(OH)Dtpp-mGDP | MetaCyc |
| molybdopterin guanine dinucleotide | MetaCyc |
| guanylyl molybdenum cofactor | MetaCyc |
| Manual Xrefs | Databases |
|---|---|
| CPD-582 | MetaCyc |
| Citations |
|---|