EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:71311 - pyrazine-2-carboxylic acid
| Formula | C5H4N2O2 |
| Net Charge | 0 |
| Average Mass | 124.099 |
| Monoisotopic Mass | 124.02728 |
| SMILES | O=C(O)c1cnccn1 |
| InChI | InChI=1S/C5H4N2O2/c8-5(9)4-3-6-1-2-7-4/h1-3H,(H,8,9) |
| InChIKey | NIPZZXUFJPQHNH-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | antitubercular agent A substance that kills or slows the growth of Mycobacterium tuberculosis and is used in the treatment of tuberculosis. |
| Application: | antitubercular agent A substance that kills or slows the growth of Mycobacterium tuberculosis and is used in the treatment of tuberculosis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pyrazine-2-carboxylic acid (CHEBI:71311) has role antitubercular agent (CHEBI:33231) |
| pyrazine-2-carboxylic acid (CHEBI:71311) has role drug metabolite (CHEBI:49103) |
| pyrazine-2-carboxylic acid (CHEBI:71311) is a pyrazinecarboxylic acid (CHEBI:48345) |
| pyrazine-2-carboxylic acid (CHEBI:71311) is conjugate acid of pyrazine-2-carboxylate (CHEBI:71266) |
| Incoming Relation(s) |
| pyrazine-2-carboxylate (CHEBI:71266) is conjugate base of pyrazine-2-carboxylic acid (CHEBI:71311) |
| IUPAC Name |
|---|
| pyrazine-2-carboxylic acid |
| Synonyms | Source |
|---|---|
| 2-Pyrazinecarboxylic acid | KEGG COMPOUND |
| Pyrazinoic acid | KEGG COMPOUND |
| Pyrazinic acid | ChemIDplus |
| Pyrazinemonocarboxylic acid | ChemIDplus |
| pyrazinecarboxylic acid | ChEBI |
| Paradiazinecarboxylic acid | NIST Chemistry WebBook |
| Manual Xrefs | Databases |
|---|---|
| VGL | PDBeChem |
| C19915 | KEGG COMPOUND |
| PYRAZINOIC-ACID | MetaCyc |
| Pyrazinoic_acid | Wikipedia |
| Citations |
|---|