EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H13N5O9PS2W |
| Net Charge | -1 |
| Average Mass | 626.188 |
| Monoisotopic Mass | 625.94071 |
| SMILES | [H][C@@]12Nc3c(nc(N)nc3=O)N[C@]1([H])O[C@H](COP(=O)(O)O)C1=C2[S][W-](=[O])(=[O])([OH])[S]1 |
| InChI | InChI=1S/C10H14N5O6PS2.H2O.2O.W/c11-10-14-7-4(8(16)15-10)12-3-6(24)5(23)2(21-9(3)13-7)1-20-22(17,18)19;;;;/h2-3,9,12,23-24H,1H2,(H2,17,18,19)(H4,11,13,14,15,16);1H2;;;/q;;;;+2/p-3/t2-,3+,9-;;;;/m1..../s1 |
| InChIKey | LJRPMZVYYIPXOS-BKZHXLINSA-K |
| Roles Classification |
|---|
| Biological Role: | cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| W(VI)O2(OH)-molybdopterin cofactor (CHEBI:71307) is a W-molybdopterin cofactor (CHEBI:60215) |
| W(VI)O2(OH)-molybdopterin cofactor (CHEBI:71307) is conjugate acid of W(VI)O2(OH)-molybdopterin cofactor(4−) (CHEBI:71305) |
| Incoming Relation(s) |
| W(VI)O2(OH)-molybdopterin cofactor(4−) (CHEBI:71305) is conjugate base of W(VI)O2(OH)-molybdopterin cofactor (CHEBI:71307) |
| IUPAC Name |
|---|
| {[(5aR,8R,9aR)-2-amino-4-oxo-6,7-bis(sulfanyl-κS)-3,5,5a,8,9a,10-hexahydro-4H-pyrano[3,2-g]pteridin-8-yl]methyl dihydrogenato(2−) phosphate}(hydroxy)bis(oxido)wolframate(1−) |
| Synonym | Source |
|---|---|
| WO2(OH)-molybdopterin cofactor | ChEBI |