EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H17N3O8SR |
| Net Charge | -1 |
| Average Mass (excl. R groups) | 363.345 |
| Monoisotopic Mass (excl. R groups) | 363.07364 |
| SMILES | *C(O)C(=O)SC[C@H](NC(=O)CC[C@H]([NH3+])C(=O)[O-])C(=O)NCC(=O)[O-] |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| S-(2-hydroxyacyl)glutathione(1−) (CHEBI:71261) is a S-acylglutathionate(1−) (CHEBI:60058) |
| S-(2-hydroxyacyl)glutathione(1−) (CHEBI:71261) is a peptide anion (CHEBI:60334) |
| S-(2-hydroxyacyl)glutathione(1−) (CHEBI:71261) is conjugate base of S-(2-hydroxyacyl)glutathione (CHEBI:17491) |
| Incoming Relation(s) |
| S-(2-hydroxyacyl)glutathione (CHEBI:17491) is conjugate acid of S-(2-hydroxyacyl)glutathione(1−) (CHEBI:71261) |
| Synonym | Source |
|---|---|
| S-(2-hydroxyacyl)glutathione anion | ChEBI |
| UniProt Name | Source |
|---|---|
| an S-(2-hydroxyacyl)glutathione | UniProt |
| Citations |
|---|