EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H16ClNO |
| Net Charge | 0 |
| Average Mass | 285.774 |
| Monoisotopic Mass | 285.09204 |
| SMILES | [H][C@@]12CN(C)C[C@@]1([H])c1cc(Cl)ccc1Oc1ccccc12 |
| InChI | InChI=1S/C17H16ClNO/c1-19-9-14-12-4-2-3-5-16(12)20-17-7-6-11(18)8-13(17)15(14)10-19/h2-8,14-15H,9-10H2,1H3/t14-,15-/m0/s1 |
| InChIKey | VSWBSWWIRNCQIJ-GJZGRUSLSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R,R)-asenapine (CHEBI:71256) is a 5-chloro-2-methyl-2,3,3a,12b-tetrahydrodibenzo[2,3:6,7]oxepino[4,5-c]pyrrole (CHEBI:71255) |
| (R,R)-asenapine (CHEBI:71256) is conjugate base of (R,R)-asenapine(1+) (CHEBI:71251) |
| (R,R)-asenapine (CHEBI:71256) is enantiomer of (S,S)-asenapine (CHEBI:71257) |
| Incoming Relation(s) |
| asenapine (CHEBI:71253) has part (R,R)-asenapine (CHEBI:71256) |
| (R,R)-asenapine(1+) (CHEBI:71251) is conjugate acid of (R,R)-asenapine (CHEBI:71256) |
| (S,S)-asenapine (CHEBI:71257) is enantiomer of (R,R)-asenapine (CHEBI:71256) |
| IUPAC Name |
|---|
| (3aR,12bR)-5-chloro-2-methyl-2,3,3a,12b-tetrahydro-1H-dibenzo[2,3:6,7]oxepino[4,5-c]pyrrole |
| Manual Xrefs | Databases |
|---|---|
| LSM-5679 | LINCS |