EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H7NO4 |
| Net Charge | 0 |
| Average Mass | 181.147 |
| Monoisotopic Mass | 181.03751 |
| SMILES | [H]C(=O)Cc1ccc(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C8H7NO4/c10-4-3-6-1-2-8(11)7(5-6)9(12)13/h1-2,4-5,11H,3H2 |
| InChIKey | OXYOFULKSNCNRY-UHFFFAOYSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-hydroxy-3-nitrophenylacetaldehyde (CHEBI:71235) is a 2-nitrophenols (CHEBI:86421) |
| 4-hydroxy-3-nitrophenylacetaldehyde (CHEBI:71235) is a phenylacetaldehydes (CHEBI:25973) |
| 4-hydroxy-3-nitrophenylacetaldehyde (CHEBI:71235) is conjugate acid of 4-hydroxy-3-nitrophenylacetaldehyde(1−) (CHEBI:71287) |
| Incoming Relation(s) |
| 4-hydroxy-3-nitrophenylacetaldehyde(1−) (CHEBI:71287) is conjugate base of 4-hydroxy-3-nitrophenylacetaldehyde (CHEBI:71235) |
| IUPAC Name |
|---|
| (4-hydroxy-3-nitrophenyl)acetaldehyde |
| Synonym | Source |
|---|---|
| 2-(4-hydroxy-3-nitrophenyl)acetaldehyde | SUBMITTER |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10153797 | Reaxys |
| Citations |
|---|