EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C80H106Cl2N11O27P |
| Net Charge | 0 |
| Average Mass | 1755.658 |
| Monoisotopic Mass | 1753.63743 |
| SMILES | CCCCCCCCCCNCCN[C@@]1(C)C[C@H](O[C@H]2[C@H](Oc3c4cc5cc3Oc3ccc(cc3Cl)[C@@H](O)[C@@H](NC(=O)[C@@H](CC(C)C)NC)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@H]5C(=O)N[C@H]3C(=O)N[C@H](C(=O)N[C@H](C(=O)O)c5cc(O)c(CNCP(=O)(O)O)c(O)c5-c5cc3ccc5O)[C@H](O)c3ccc(c(Cl)c3)O4)O[C@H](CO)[C@@H](O)[C@@H]2O)O[C@@H](C)[C@H]1O |
| InChI | InChI=1S/C80H106Cl2N11O27P/c1-7-8-9-10-11-12-13-14-21-85-22-23-87-80(5)32-57(115-37(4)71(80)103)119-70-68(102)67(101)55(34-94)118-79(70)120-69-53-28-41-29-54(69)117-52-20-17-40(27-46(52)82)65(99)63-77(109)91-61(78(110)111)43-30-50(96)44(33-86-35-121(112,113)114)66(100)58(43)42-25-38(15-18-49(42)95)59(74(106)93-63)90-75(107)60(41)89-73(105)48(31-56(83)97)88-76(108)62(92-72(104)47(84-6)24-36(2)3)64(98)39-16-19-51(116-53)45(81)26-39/h15-20,25-30,36-37,47-48,55,57,59-65,67-68,70-71,79,84-87,94-96,98-103H,7-14,21-24,31-35H2,1-6H3,(H2,83,97)(H,88,108)(H,89,105)(H,90,107)(H,91,109)(H,92,104)(H,93,106)(H,110,111)(H2,112,113,114)/t37-,47+,48-,55+,57-,59+,60+,61-,62+,63-,64+,65+,67+,68-,70+,71+,79-,80-/m0/s1 |
| InChIKey | ONUMZHGUFYIKPM-MXNFEBESSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antibacterial drug A drug used to treat or prevent bacterial infections. |
| Application: | antibacterial drug A drug used to treat or prevent bacterial infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| telavancin (CHEBI:71229) has functional parent vancomycin (CHEBI:28001) |
| telavancin (CHEBI:71229) has role antibacterial drug (CHEBI:36047) |
| telavancin (CHEBI:71229) has role antimicrobial agent (CHEBI:33281) |
| telavancin (CHEBI:71229) is a glycopeptide (CHEBI:24396) |
| Incoming Relation(s) |
| telavancin hydrochloride (CHEBI:71226) has part telavancin (CHEBI:71229) |
| INNs | Source |
|---|---|
| telavancin | ChemIDplus |
| telavancina | WHO MedNet |
| télavancine | WHO MedNet |
| telavancinum | WHO MedNet |
| Synonym | Source |
|---|---|
| N3''-[2-(decylamino)ethyl]-29-{[(phosphonomethyl)amino]methyl}vancomycin | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 4116 | DrugCentral |
| Telavancin | Wikipedia |
| WO2008085913 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9988046 | Reaxys |
| CAS:372151-71-8 | ChemIDplus |
| Citations |
|---|