EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H12O4 |
| Net Charge | 0 |
| Average Mass | 208.213 |
| Monoisotopic Mass | 208.07356 |
| SMILES | COC(=O)C(CC(=O)O)c1ccccc1 |
| InChI | InChI=1S/C11H12O4/c1-15-11(14)9(7-10(12)13)8-5-3-2-4-6-8/h2-6,9H,7H2,1H3,(H,12,13) |
| InChIKey | KFUIOHIUIZFOOW-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-methoxy-4-oxo-3-phenylbutanoic acid (CHEBI:71214) has functional parent succinic acid (CHEBI:15741) |
| 4-methoxy-4-oxo-3-phenylbutanoic acid (CHEBI:71214) is a dicarboxylic acid monoester (CHEBI:36244) |
| 4-methoxy-4-oxo-3-phenylbutanoic acid (CHEBI:71214) is a methyl ester (CHEBI:25248) |
| 4-methoxy-4-oxo-3-phenylbutanoic acid (CHEBI:71214) is conjugate acid of 4-methoxy-4-oxo-3-phenylbutanoate (CHEBI:71190) |
| Incoming Relation(s) |
| 4-methoxy-4-oxo-3-phenylbutanoate (CHEBI:71190) is conjugate base of 4-methoxy-4-oxo-3-phenylbutanoic acid (CHEBI:71214) |
| IUPAC Name |
|---|
| 4-methoxy-4-oxo-3-phenylbutanoic acid |
| Synonyms | Source |
|---|---|
| 3-methoxycarbonyl-3-phenylbutyric acid | ChEBI |
| 4-methoxy-4-oxo-3-phenylbutyric acid | ChEBI |
| 3-methoxycarbonyl-3-phenylbutanoic acid | ChEBI |
| 1-methyl 2-phenylsuccinate | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1971098 | Reaxys |
| CAS:54897-85-7 | Reaxys |