EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:71207 - (2Z,4E)-2-hydroxy-6-oxohexa-2,4-dienoic acid
| Formula | C6H6O4 |
| Net Charge | 0 |
| Average Mass | 142.110 |
| Monoisotopic Mass | 142.02661 |
| SMILES | [H]C(=O)/C=C/C=C(\O)C(=O)O |
| InChI | InChI=1S/C6H6O4/c7-4-2-1-3-5(8)6(9)10/h1-4,8H,(H,9,10)/b2-1+,5-3- |
| InChIKey | KGLCZTRXNNGESL-WFTYEQLWSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2Z,4E)-2-hydroxy-6-oxohexa-2,4-dienoic acid (CHEBI:71207) is a 2-hydroxy-6-oxohexa-2,4-dienoic acid (CHEBI:17236) |
| (2Z,4E)-2-hydroxy-6-oxohexa-2,4-dienoic acid (CHEBI:71207) is conjugate acid of (2Z,4E)-2-hydroxy-6-oxohexa-2,4-dienoate (CHEBI:71198) |
| Incoming Relation(s) |
| (2Z,4E)-2-hydroxy-6-oxohexa-2,4-dienoate (CHEBI:71198) is conjugate base of (2Z,4E)-2-hydroxy-6-oxohexa-2,4-dienoic acid (CHEBI:71207) |
| IUPAC Name |
|---|
| (2Z,4E)-2-hydroxy-6-oxohexa-2,4-dienoic acid |