EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H10O4 |
| Net Charge | 0 |
| Average Mass | 218.208 |
| Monoisotopic Mass | 218.05791 |
| SMILES | O=C1C(O)=C(CCO)C(=O)c2ccccc21 |
| InChI | InChI=1S/C12H10O4/c13-6-5-9-10(14)7-3-1-2-4-8(7)11(15)12(9)16/h1-4,13,16H,5-6H2 |
| InChIKey | XMPOZGVQVZPRFL-UHFFFAOYSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-hydroxy-3-(2-hydroxyethyl)naphthalene-1,4-dione (CHEBI:71184) is a diol (CHEBI:23824) |
| 2-hydroxy-3-(2-hydroxyethyl)naphthalene-1,4-dione (CHEBI:71184) is a hydroxy-1,4-naphthoquinone (CHEBI:132157) |
| 2-hydroxy-3-(2-hydroxyethyl)naphthalene-1,4-dione (CHEBI:71184) is conjugate acid of 3-(2-hydroxyethyl)-1,4-dioxo-1,4-dihydronaphthalen-2-olate (CHEBI:71183) |
| Incoming Relation(s) |
| 3-(2-hydroxyethyl)-1,4-dioxo-1,4-dihydronaphthalen-2-olate (CHEBI:71183) is conjugate base of 2-hydroxy-3-(2-hydroxyethyl)naphthalene-1,4-dione (CHEBI:71184) |
| IUPAC Name |
|---|
| 2-hydroxy-3-(2-hydroxyethyl)naphthalene-1,4-dione |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9562455 | Reaxys |