EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H15N5O4 |
| Net Charge | 0 |
| Average Mass | 257.250 |
| Monoisotopic Mass | 257.11240 |
| SMILES | Nc1nc2c(c(=O)n1)NC([C@H](O)[C@@H](O)CO)CN2 |
| InChI | InChI=1S/C9H15N5O4/c10-9-13-7-5(8(18)14-9)12-3(1-11-7)6(17)4(16)2-15/h3-4,6,12,15-17H,1-2H2,(H4,10,11,13,14,18)/t3?,4-,6-/m0/s1 |
| InChIKey | XHIXPVCTDRNTTC-YQVKZWHSSA-N |
| Roles Classification |
|---|
| Biological Role: | cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tetrahydromonapterin (CHEBI:71177) has role cofactor (CHEBI:23357) |
| tetrahydromonapterin (CHEBI:71177) is a neopterins (CHEBI:25500) |
| tetrahydromonapterin (CHEBI:71177) is a tetrahydropterin (CHEBI:30436) |
| IUPAC Name |
|---|
| 2-amino-6-[(1S,2S)-1,2,3-trihydroxypropyl]-5,6,7,8-tetrahydropteridin-4(3H)-one |
| Synonyms | Source |
|---|---|
| 5,6,7,8-tetrahydromonapterin | ChEBI |
| H4-MPt | SUBMITTER |
| UniProt Name | Source |
|---|---|
| 5,6,7,8-tetrahydromonapterin | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD0-2101 | MetaCyc |
| Citations |
|---|