EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H35NO6PR |
| Net Charge | 0 |
| Average Mass (excl. R groups) | 392.448 |
| Monoisotopic Mass (excl. R groups) | 392.22020 |
| SMILES | *C(=O)N[C@@H](COP(=O)(O)O)[C@H](O)/C=C/CCCCCCCCCC(C)C |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-acyl-15-methylhexadecasphing-4-enine-1-phosphate (CHEBI:71165) has functional parent 15-methylhexadecasphing-4-enine (CHEBI:70798) |
| N-acyl-15-methylhexadecasphing-4-enine-1-phosphate (CHEBI:71165) is a ceramide 1-phosphate (CHEBI:13956) |
| N-acyl-15-methylhexadecasphing-4-enine-1-phosphate (CHEBI:71165) is conjugate acid of N-acyl-15-methylhexadecasphing-4-enine-1-phosphate(2−) (CHEBI:71156) |
| Incoming Relation(s) |
| N-acyl-15-methylhexadecasphing-4-enine-1-phosphate(2−) (CHEBI:71156) is conjugate base of N-acyl-15-methylhexadecasphing-4-enine-1-phosphate (CHEBI:71165) |
| Synonym | Source |
|---|---|
| N-acyl-15-methylhexadecasphingosine-1-phosphate | ChEBI |