EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H5NO4 |
| Net Charge | 0 |
| Average Mass | 155.109 |
| Monoisotopic Mass | 155.02186 |
| SMILES | O=C(O)c1cncc1C(=O)O |
| InChI | InChI=1S/C6H5NO4/c8-5(9)3-1-7-2-4(3)6(10)11/h1-2,7H,(H,8,9)(H,10,11) |
| InChIKey | JFVDNCRMBALUKH-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pyrrole-3,4-dicarboxylic acid (CHEBI:71162) has role metabolite (CHEBI:25212) |
| pyrrole-3,4-dicarboxylic acid (CHEBI:71162) is a pyrroledicarboxylic acid (CHEBI:59197) |
| IUPAC Name |
|---|
| 1H-pyrrole-3,4-dicarboxylic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:128615 | Reaxys |
| Citations |
|---|