EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H10N2O3 |
| Net Charge | 0 |
| Average Mass | 194.190 |
| Monoisotopic Mass | 194.06914 |
| SMILES | O=C(O)CNC(=O)Cc1cccnc1 |
| InChI | InChI=1S/C9H10N2O3/c12-8(11-6-9(13)14)4-7-2-1-3-10-5-7/h1-3,5H,4,6H2,(H,11,12)(H,13,14) |
| InChIKey | YVAORMCUQHSLMO-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-pyridylacetylglycine (CHEBI:71057) has role metabolite (CHEBI:25212) |
| 3-pyridylacetylglycine (CHEBI:71057) is a N-acylglycine (CHEBI:16180) |
| 3-pyridylacetylglycine (CHEBI:71057) is a pyridines (CHEBI:26421) |
| IUPAC Names |
|---|
| N-(pyridin-3-ylacetyl)glycine |
| [(pyridin-3-ylacetyl)amino]acetic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:477084 | Reaxys |
| Citations |
|---|