EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H35NO2 |
| Net Charge | 0 |
| Average Mass | 273.461 |
| Monoisotopic Mass | 273.26678 |
| SMILES | CCCCCCCCCCCCC[C@@H](O)[C@@H](N)CO |
| InChI | InChI=1S/C16H35NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-16(19)15(17)14-18/h15-16,18-19H,2-14,17H2,1H3/t15-,16+/m0/s1 |
| InChIKey | ZKLREJQHRKUJHD-JKSUJKDBSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hexadecasphinganine (CHEBI:71050) has functional parent hexadecasphing-4-enine (CHEBI:71052) |
| hexadecasphinganine (CHEBI:71050) is a aminodiol (CHEBI:22501) |
| hexadecasphinganine (CHEBI:71050) is a sphingoid (CHEBI:35785) |
| hexadecasphinganine (CHEBI:71050) is conjugate base of hexadecasphinganine(1+) (CHEBI:71009) |
| Incoming Relation(s) |
| N-acylhexadecasphinganine (CHEBI:82881) has functional parent hexadecasphinganine (CHEBI:71050) |
| N-acylhexadecasphinganine-1-phosphocholine (CHEBI:82895) has functional parent hexadecasphinganine (CHEBI:71050) |
| N-acylhexadecasphinganine-1-phosphoethanolamine (CHEBI:83751) has functional parent hexadecasphinganine (CHEBI:71050) |
| N-acylhexadecasphinganine-1-phosphoethanolamine zwitterion (CHEBI:82906) has functional parent hexadecasphinganine (CHEBI:71050) |
| hexadecasphinganine-based sphingolipid (CHEBI:82820) has functional parent hexadecasphinganine (CHEBI:71050) |
| hexadecasphinganine(1+) (CHEBI:71009) is conjugate acid of hexadecasphinganine (CHEBI:71050) |
| IUPAC Name |
|---|
| (2S,3R)-2-aminohexadecane-1,3-diol |
| Synonyms | Source |
|---|---|
| C16 dihydrosphingosine | ChEBI |
| C16 sphinganine | LIPID MAPS |
| hexadecadihydrosphingosine | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C13915 | KEGG COMPOUND |
| LMSP01040001 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11038472 | Reaxys |
| Citations |
|---|