EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H16N2O4 |
| Net Charge | 0 |
| Average Mass | 252.270 |
| Monoisotopic Mass | 252.11101 |
| SMILES | N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CO)C(=O)O |
| InChI | InChI=1S/C12H16N2O4/c13-9(6-8-4-2-1-3-5-8)11(16)14-10(7-15)12(17)18/h1-5,9-10,15H,6-7,13H2,(H,14,16)(H,17,18)/t9-,10-/m0/s1 |
| InChIKey | ROHDXJUFQVRDAV-UWVGGRQHSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Phe-Ser (CHEBI:71032) has functional parent L-phenylalanine (CHEBI:17295) |
| Phe-Ser (CHEBI:71032) has functional parent L-serine (CHEBI:17115) |
| Phe-Ser (CHEBI:71032) has role metabolite (CHEBI:25212) |
| Phe-Ser (CHEBI:71032) is a dipeptide (CHEBI:46761) |
| IUPAC Names |
|---|
| (2S)-2-{[(2S)-2-amino-3-phenylpropanoyl]amino}-3-hydroxypropanoic acid |
| L-phenylalanyl-L-serine |
| Synonyms | Source |
|---|---|
| Phenylalanylserine | IUBMB |
| FS | ChEBI |
| L-Phe-L-Ser | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0029004 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4752699 | Reaxys |
| CAS:16053-39-7 | ChemIDplus |
| Citations |
|---|