EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H14ClNO4 |
| Net Charge | 0 |
| Average Mass | 343.766 |
| Monoisotopic Mass | 343.06114 |
| SMILES | COc1ccc2c(c1)c(CC(=O)O)cn2C(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H14ClNO4/c1-24-14-6-7-16-15(9-14)12(8-17(21)22)10-20(16)18(23)11-2-4-13(19)5-3-11/h2-7,9-10H,8H2,1H3,(H,21,22) |
| InChIKey | DHEMTWWLRLOBKI-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-demethylindomethacin (CHEBI:71026) is a N-acylindole (CHEBI:75884) |
| 2-demethylindomethacin (CHEBI:71026) is a indole-3-acetic acids (CHEBI:24803) |
| 2-demethylindomethacin (CHEBI:71026) is a monochlorobenzenes (CHEBI:83403) |
| IUPAC Name |
|---|
| [1-(4-chlorobenzoyl)-5-methoxy-1H-indol-3-yl]acetic acid |
| Synonyms | Source |
|---|---|
| 1-(4-chlorobenzoyl)-5-methoxy-1H-indole-3-acetic acid | ChEBI |
| 2-des-methylindomethacin | ChEBI |
| 2'-des-methyl indomethacin | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:440457 | Reaxys |
| Citations |
|---|