EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H21N3O |
| Net Charge | 0 |
| Average Mass | 307.397 |
| Monoisotopic Mass | 307.16846 |
| SMILES | [H]C(=O)c1cnc2n1CCc1ccccc1C2=C1CCN(C)CC1 |
| InChI | InChI=1S/C19H21N3O/c1-21-9-6-15(7-10-21)18-17-5-3-2-4-14(17)8-11-22-16(13-23)12-20-19(18)22/h2-5,12-13H,6-11H2,1H3 |
| InChIKey | MWTBKTRZPHJQLH-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. |
| Applications: | anti-allergic agent A drug used to treat allergic reactions. H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| alcaftadine (CHEBI:71023) has role anti-allergic agent (CHEBI:50857) |
| alcaftadine (CHEBI:71023) has role H1-receptor antagonist (CHEBI:37955) |
| alcaftadine (CHEBI:71023) is a aldehyde (CHEBI:17478) |
| alcaftadine (CHEBI:71023) is a imidazobenzazepine (CHEBI:71024) |
| alcaftadine (CHEBI:71023) is a piperidines (CHEBI:26151) |
| alcaftadine (CHEBI:71023) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| 11-(1-methylpiperidin-4-ylidene)-6,11-dihydro-5H-imidazo[2,1-b][3]benzazepine-3-carbaldehyde |
| INNs | Source |
|---|---|
| alcaftadina | WHO MedNet |
| alcaftadine | WHO MedNet |
| alcaftadine | KEGG DRUG |
| alcaftadinum | WHO MedNet |
| Brand Name | Source |
|---|---|
| Lastacaft | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| 4165 | DrugCentral |
| Alcaftadine | Wikipedia |
| CN101460176 | Patent |
| D06552 | KEGG DRUG |
| DB06766 | DrugBank |
| HMDB0015670 | HMDB |
| KR20080110881 | Patent |
| MX2008012657 | Patent |
| US2008051385 | Patent |
| US2008139531 | Patent |
| US2012094978 | Patent |
| US5468743 | Patent |
| WO2007117971 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:13759211 | Reaxys |
| CAS:147084-10-4 | KEGG DRUG |
| CAS:147084-10-4 | ChemIDplus |
| Citations |
|---|