EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H46O9 |
| Net Charge | 0 |
| Average Mass | 550.689 |
| Monoisotopic Mass | 550.31418 |
| SMILES | [H][C@]12CC[C@]3([H])[C@]([H])(CC[C@@]4(C)[C@]3(O)CC[C@]4([H])C3=CC(=O)OC3)[C@@]1(C)[C@H](O)C[C@H](O[C@@H]1O[C@@H](C)[C@@H](O)[C@@H](OC)[C@H]1O)C2 |
| InChI | InChI=1S/C30H46O9/c1-15-24(33)26(36-4)25(34)27(38-15)39-18-12-17-5-6-21-20(29(17,3)22(31)13-18)7-9-28(2)19(8-10-30(21,28)35)16-11-23(32)37-14-16/h11,15,17-22,24-27,31,33-35H,5-10,12-14H2,1-4H3/t15-,17+,18+,19+,20-,21+,22+,24+,25+,26+,27-,28+,29-,30-/m0/s1 |
| InChIKey | DKYDBQQIQAPGMH-XGOVAQEESA-N |
| Roles Classification |
|---|
| Application: | cardioprotective agent Any protective agent that is able to prevent damage to the heart. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| acovenoside A (CHEBI:71022) is a cardenolide glycoside (CHEBI:38092) |
| IUPAC Name |
|---|
| 3β-(6-deoxy-3-O-methyl-α-L-talopyranosyloxy)-1β,14-dihydroxy-5β-card-20(22)-enolide |
| Registry Numbers | Sources |
|---|---|
| Reaxys:70810 | Reaxys |
| CAS:663-95-6 | ChemIDplus |
| Citations |
|---|