EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H9NO4 |
| Net Charge | 0 |
| Average Mass | 195.174 |
| Monoisotopic Mass | 195.05316 |
| SMILES | O=C(O)CNC(=O)c1ccc(O)cc1 |
| InChI | InChI=1S/C9H9NO4/c11-7-3-1-6(2-4-7)9(14)10-5-8(12)13/h1-4,11H,5H2,(H,10,14)(H,12,13) |
| InChIKey | ZMHLUFWWWPBTIU-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | blood (UBERON:0000178) | PubMed (2620456) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | human blood serum metabolite Any metabolite (endogenous or exogenous) found in human blood serum samples. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| p-hydroxyhippuric acid (CHEBI:71018) has functional parent N-benzoylglycine (CHEBI:18089) |
| p-hydroxyhippuric acid (CHEBI:71018) has role human blood serum metabolite (CHEBI:85234) |
| p-hydroxyhippuric acid (CHEBI:71018) is a N-acylglycine (CHEBI:16180) |
| p-hydroxyhippuric acid (CHEBI:71018) is conjugate acid of p-hydroxyhippurate (CHEBI:133613) |
| Incoming Relation(s) |
| p-hydroxyhippurate (CHEBI:133613) is conjugate base of p-hydroxyhippuric acid (CHEBI:71018) |
| IUPAC Names |
|---|
| [(4-hydroxybenzoyl)amino]acetic acid |
| N-(4-hydroxybenzoyl)glycine |
| Synonyms | Source |
|---|---|
| 4-Hydroxybenzoylglycine | ChemIDplus |
| 4-Hydroxyhippuric acid | HMDB |
| Manual Xrefs | Databases |
|---|---|
| HMDB0013678 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2110458 | Reaxys |
| CAS:2482-25-9 | ChemIDplus |
| Citations |
|---|