EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H15N3O |
| Net Charge | 0 |
| Average Mass | 349.393 |
| Monoisotopic Mass | 349.12151 |
| SMILES | N#Cc1ccccc1-c1cc(-c2ccccn2)cn(-c2ccccc2)c1=O |
| InChI | InChI=1S/C23H15N3O/c24-15-17-8-4-5-11-20(17)21-14-18(22-12-6-7-13-25-22)16-26(23(21)27)19-9-2-1-3-10-19/h1-14,16H |
| InChIKey | PRMWGUBFXWROHD-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | AMPA receptor antagonist An antagonist at the AMPA receptor. |
| Application: | anticonvulsant A drug used to prevent seizures or reduce their severity. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| perampanel (CHEBI:71013) has functional parent benzonitrile (CHEBI:27991) |
| perampanel (CHEBI:71013) has role AMPA receptor antagonist (CHEBI:71014) |
| perampanel (CHEBI:71013) has role anticonvulsant (CHEBI:35623) |
| perampanel (CHEBI:71013) is a bipyridines (CHEBI:50511) |
| perampanel (CHEBI:71013) is a nitrile (CHEBI:18379) |
| perampanel (CHEBI:71013) is a pyridone (CHEBI:38183) |
| Incoming Relation(s) |
| perampanel hydrate (CHEBI:71015) has part perampanel (CHEBI:71013) |
| IUPAC Name |
|---|
| 2-(6'-oxo-1'-phenyl-1',6'-dihydro-2,3'-bipyridin-5'-yl)benzonitrile |
| INNs | Source |
|---|---|
| pérampanel | WHO MedNet |
| perampanel | WHO MedNet |
| perampanel | WHO MedNet |
| perampanelum | WHO MedNet |
| Synonyms | Source |
|---|---|
| 3-(2-Cyanophenyl)-5-(2-pyridyl)-1-phenyl-1,2-dihydropyridin-2-one | ChemIDplus |
| E 2007 | ChemIDplus |
| ER-155055-90 | ChemIDplus |
| E2007 | ChemIDplus |
| Brand Name | Source |
|---|---|
| Fycompa | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| D08964 | KEGG DRUG |
| Perampanel | Wikipedia |
| US2009088574 | Patent |
| US2008108603 | Patent |
| WO2008111590 | Patent |
| WO2006107859 | Patent |
| EP1875912 | Patent |
| 4684 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11343244 | Reaxys |
| CAS:380917-97-5 | KEGG DRUG |
| CAS:380917-97-5 | ChemIDplus |
| Citations |
|---|