EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H14N4O3 |
| Net Charge | 0 |
| Average Mass | 190.203 |
| Monoisotopic Mass | 190.10659 |
| SMILES | N/C(=N/O)NCCCC(N)C(=O)O |
| InChI | InChI=1S/C6H14N4O3/c7-4(5(11)12)2-1-3-9-6(8)10-13/h4,13H,1-3,7H2,(H,11,12)(H3,8,9,10) |
| InChIKey | FQWRAVYMZULPNK-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N5-[(Z)-amino(hydroxyimino)methyl]ornithine (CHEBI:7101) has role human metabolite (CHEBI:77746) |
| N5-[(Z)-amino(hydroxyimino)methyl]ornithine (CHEBI:7101) has role mouse metabolite (CHEBI:75771) |
| N5-[(Z)-amino(hydroxyimino)methyl]ornithine (CHEBI:7101) is a N5-[amino(hydroxyimino)methyl]ornithine (CHEBI:47826) |
| Incoming Relation(s) |
| N5-[(Z)-amino(hydroxyimino)methyl]-L-ornithine (CHEBI:47822) is a N5-[(Z)-amino(hydroxyimino)methyl]ornithine (CHEBI:7101) |
| IUPAC Name |
|---|
| N5-[(Z)-amino(hydroxyimino)methyl]ornithine |
| Synonym | Source |
|---|---|
| N-(omega)-Hydroxyarginine | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C05933 | KEGG COMPOUND |