EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C43H66O15 |
| Net Charge | 0 |
| Average Mass | 822.986 |
| Monoisotopic Mass | 822.44017 |
| SMILES | [H][C@]12CC[C@]3([H])[C@]([H])(C[C@@H](OC(C)=O)[C@]4(C)[C@@H](C5=CC(=O)OC5)CC[C@@]43O)[C@@]1(C)CC[C@H](O[C@H]1C[C@H](O)[C@H](O[C@H]3C[C@H](O)[C@H](O[C@H]4C[C@H](O)[C@H](O)[C@@H](C)O4)[C@@H](C)O3)[C@@H](C)O1)C2 |
| InChI | InChI=1S/C43H66O15/c1-20-38(49)30(45)16-36(52-20)57-40-22(3)54-37(18-32(40)47)58-39-21(2)53-35(17-31(39)46)56-26-9-11-41(5)25(14-26)7-8-28-29(41)15-33(55-23(4)44)42(6)27(10-12-43(28,42)50)24-13-34(48)51-19-24/h13,20-22,25-33,35-40,45-47,49-50H,7-12,14-19H2,1-6H3/t20-,21-,22-,25-,26+,27-,28-,29+,30+,31+,32+,33-,35+,36+,37+,38-,39-,40-,41+,42+,43+/m1/s1 |
| InChIKey | RNBLZKNCMWHSIG-DXJNJSHLSA-N |
| Roles Classification |
|---|
| Application: | cardioprotective agent Any protective agent that is able to prevent damage to the heart. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 12-O-acetyldigoxin (CHEBI:71006) has functional parent digoxin (CHEBI:4551) |
| 12-O-acetyldigoxin (CHEBI:71006) is a acetate ester (CHEBI:47622) |
| 12-O-acetyldigoxin (CHEBI:71006) is a cardenolide glycoside (CHEBI:38092) |
| IUPAC Name |
|---|
| 12β-(acetyloxy)-3β-[2,6-dideoxy-β-D-ribo-hexopyranosyl-(1→4)-2,6-dideoxy-β-D-ribo-hexopyranosyl-(1→4)-2,6-dideoxy-β-D-ribo-hexopyranosyloxy]-14-hydroxy-5β-card-20(22)-enolide |
| Synonyms | Source |
|---|---|
| 12-Acetyldigoxin | ChemIDplus |
| Digoxigenin tridigitoxoside-12-acetate | ChemIDplus |
| Digoxin 12-acetate | ChEBI |
| Digoxin, 12-acetate | ChemIDplus |
| digoxin 12β-acetate | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| CAS:20991-71-3 | ChemIDplus |
| Citations |
|---|