EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H44O8 |
| Net Charge | 0 |
| Average Mass | 520.663 |
| Monoisotopic Mass | 520.30362 |
| SMILES | [H][C@]12CC[C@]3([H])[C@]([H])(CC[C@@]4(C)[C@]3(O)CC[C@]4([H])C3=CC(=O)OC3)[C@@]1(C)CC[C@H](O[C@@H]1O[C@@H](C)[C@H](O)[C@@H](O)[C@H]1O)C2 |
| InChI | InChI=1S/C29H44O8/c1-15-23(31)24(32)25(33)26(36-15)37-18-6-9-27(2)17(13-18)4-5-21-20(27)7-10-28(3)19(8-11-29(21,28)34)16-12-22(30)35-14-16/h12,15,17-21,23-26,31-34H,4-11,13-14H2,1-3H3/t15-,17+,18-,19+,20-,21+,23-,24+,25+,26-,27-,28+,29-/m0/s1 |
| InChIKey | WQMLFJWIKARBFW-BKKMTDGVSA-N |
| Roles Classification |
|---|
| Application: | cardioprotective agent Any protective agent that is able to prevent damage to the heart. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| evomonoside (CHEBI:71000) has functional parent digitoxigenin (CHEBI:42219) |
| evomonoside (CHEBI:71000) is a cardenolide glycoside (CHEBI:38092) |
| IUPAC Name |
|---|
| 3β-(6-deoxy-α-L-mannopyranosyloxy)-14-hydroxy-5β-card-20(22)-enolide |
| Synonyms | Source |
|---|---|
| 3β-(α-L-rhamnopyranosyloxy)-14-hydroxy-5β-card-20(22)-enolide | IUPAC |
| Digitoxigenin 3-rhamnoside | ChemIDplus |
| Digitoxigenin rhamnoside | ChemIDplus |
| digitoxigenin α-L-rhamnoside | ChEBI |
| Evomonosid | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:100629 | Reaxys |
| CAS:508-93-0 | ChemIDplus |
| Citations |
|---|