EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H31NO4 |
| Net Charge | 0 |
| Average Mass | 301.427 |
| Monoisotopic Mass | 301.22531 |
| SMILES | CCCCCCCCC(=O)OC(CC(=O)[O-])C[N+](C)(C)C |
| InChI | InChI=1S/C16H31NO4/c1-5-6-7-8-9-10-11-16(20)21-14(12-15(18)19)13-17(2,3)4/h14H,5-13H2,1-4H3 |
| InChIKey | MPSPNFAQQQMFLK-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| O-nonanoylcarnitine (CHEBI:70997) has role metabolite (CHEBI:25212) |
| O-nonanoylcarnitine (CHEBI:70997) is a C9-acylcarnitine (CHEBI:86493) |
| Incoming Relation(s) |
| O-nonanoyl-L-carnitine (CHEBI:85527) is a O-nonanoylcarnitine (CHEBI:70997) |
| IUPAC Name |
|---|
| 3-(nonanoyloxy)-4-(trimethylazaniumyl)butanoate |
| Synonym | Source |
|---|---|
| 3-(nonanoyloxy)-4-(trimethylammonio)butanoate | IUPAC |
| Manual Xrefs | Databases |
|---|---|
| HMDB0013288 | HMDB |
| Citations |
|---|