EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C42H64O15 |
| Net Charge | 0 |
| Average Mass | 808.959 |
| Monoisotopic Mass | 808.42452 |
| SMILES | [H]C(=O)O[C@H]1C[C@]2(O)[C@]3([H])CC[C@]4([H])C[C@@H](O[C@H]5C[C@H](O)[C@H](O[C@H]6C[C@H](O)[C@H](O[C@H]7C[C@H](O)[C@H](O)[C@@H](C)O7)[C@@H](C)O6)[C@@H](C)O5)CC[C@]4(C)[C@@]3([H])CC[C@]2(C)[C@@]1([H])C1=CC(=O)OC1 |
| InChI | InChI=1S/C42H64O15/c1-20-37(48)28(44)14-34(52-20)56-39-22(3)54-35(16-30(39)46)57-38-21(2)53-33(15-29(38)45)55-25-8-10-40(4)24(13-25)6-7-27-26(40)9-11-41(5)36(23-12-32(47)50-18-23)31(51-19-43)17-42(27,41)49/h12,19-22,24-31,33-39,44-46,48-49H,6-11,13-18H2,1-5H3/t20-,21-,22-,24-,25+,26+,27-,28+,29+,30+,31+,33+,34+,35+,36+,37-,38-,39-,40+,41-,42+/m1/s1 |
| InChIKey | GZZJHPZDXZCDDA-MBJUQXSJSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | cardioprotective agent Any protective agent that is able to prevent damage to the heart. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| gitaloxin (CHEBI:70996) has functional parent gitoxin (CHEBI:28503) |
| gitaloxin (CHEBI:70996) has role metabolite (CHEBI:25212) |
| gitaloxin (CHEBI:70996) is a cardenolide glycoside (CHEBI:38092) |
| IUPAC Name |
|---|
| 3β-[2,6-dideoxy-β-D-ribo-hexopyranosyl-(1→4)-2,6-dideoxy-β-D-ribo-hexopyranosyl-(1→4)-2,6-dideoxy-β-D-ribo-hexopyranosyloxy]-16β-(formyloxy)-14-hydroxy-5β-card-20(22)-enolide |
| INNs | Source |
|---|---|
| gitaloxin | ChemIDplus |
| gitaloxina | ChemIDplus |
| gitaloxine | ChemIDplus |
| gitaloxinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 16-Formyl-gitoxin | ChemIDplus |
| O1616-formylgitoxin | ChEBI |
| Gitaloxigenin-tridigitoxosid | ChemIDplus |
| Gitoxin 16-formate | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:77277 | Reaxys |
| CAS:3261-53-8 | ChemIDplus |
| Citations |
|---|