EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H46O9 |
| Net Charge | 0 |
| Average Mass | 550.689 |
| Monoisotopic Mass | 550.31418 |
| SMILES | [H][C@]12CC[C@]3([H])[C@]([H])(CC[C@@]4(C)[C@]3(O)C[C@H](O)[C@]4([H])C3=CC(=O)OC3)[C@@]1(C)CC[C@H](O[C@@H]1O[C@H](C)[C@H](O)[C@H](OC)[C@H]1O)C2 |
| InChI | InChI=1S/C30H46O9/c1-15-24(33)26(36-4)25(34)27(38-15)39-18-7-9-28(2)17(12-18)5-6-20-19(28)8-10-29(3)23(16-11-22(32)37-14-16)21(31)13-30(20,29)35/h11,15,17-21,23-27,31,33-35H,5-10,12-14H2,1-4H3/t15-,17-,18+,19+,20-,21+,23+,24+,25-,26+,27+,28+,29-,30+/m1/s1 |
| InChIKey | CPFNIKYEDJFRAT-RVPZLBNISA-N |
| Roles Classification |
|---|
| Application: | cardioprotective agent Any protective agent that is able to prevent damage to the heart. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| strospeside (CHEBI:70992) has functional parent gitoxigenin (CHEBI:38105) |
| strospeside (CHEBI:70992) is a cardenolide glycoside (CHEBI:38092) |
| IUPAC Name |
|---|
| 3β-(6-deoxy-3-O-methyl-β-D-galactopyranosyloxy)-14,16β-dihydroxy-5β-card-20(22)-enolide |
| Synonym | Source |
|---|---|
| gitoxigenin 3-O-β-D-digitalopyranoside | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3659140 | Reaxys |
| CAS:595-21-1 | ChemIDplus |
| Citations |
|---|