EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H35NO5P |
| Net Charge | -1 |
| Average Mass | 364.443 |
| Monoisotopic Mass | 364.22583 |
| SMILES | CC(C)CCCCCCCCC/C=C/[C@@H](O)[C@@H]([NH3+])COP(=O)([O-])[O-] |
| InChI | InChI=1S/C17H36NO5P/c1-15(2)12-10-8-6-4-3-5-7-9-11-13-17(19)16(18)14-23-24(20,21)22/h11,13,15-17,19H,3-10,12,14,18H2,1-2H3,(H2,20,21,22)/p-1/b13-11+/t16-,17+/m0/s1 |
| InChIKey | KGHLSJONZZZQPJ-KORIGIIASA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 15-methylhexadecasphing-4-enine 1-phosphate(1−) (CHEBI:70991) is a sphingoid 1-phosphate(1−) (CHEBI:76941) |
| 15-methylhexadecasphing-4-enine 1-phosphate(1−) (CHEBI:70991) is conjugate base of 15-methylhexadecasphing-4-enine 1-phosphate (CHEBI:71036) |
| Incoming Relation(s) |
| 15-methylhexadecasphing-4-enine 1-phosphate (CHEBI:71036) is conjugate acid of 15-methylhexadecasphing-4-enine 1-phosphate(1−) (CHEBI:70991) |
| IUPAC Name |
|---|
| (2S,3R,4E)-2-azaniumyl-3-hydroxy-15-methylhexadec-4-en-1-yl phosphate |
| Synonym | Source |
|---|---|
| 15-methylhexadecasphingosine 1-phosphate(1−) | ChEBI |
| UniProt Name | Source |
|---|---|
| 15-methylhexadecasphing-4-enine 1-phosphate | UniProt |