EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H11NO3 |
| Net Charge | 0 |
| Average Mass | 145.158 |
| Monoisotopic Mass | 145.07389 |
| SMILES | CC(C)C(=O)NCC(=O)O |
| InChI | InChI=1S/C6H11NO3/c1-4(2)6(10)7-3-5(8)9/h4H,3H2,1-2H3,(H,7,10)(H,8,9) |
| InChIKey | DCICDMMXFIELDF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | human urinary metabolite Any metabolite (endogenous or exogenous) found in human urine samples. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-isobutyrylglycine (CHEBI:70979) has role human urinary metabolite (CHEBI:84087) |
| N-isobutyrylglycine (CHEBI:70979) is a N-acylglycine (CHEBI:16180) |
| N-isobutyrylglycine (CHEBI:70979) is conjugate acid of N-isobutyrylglycinate (CHEBI:133610) |
| Incoming Relation(s) |
| N-isobutyrylglycinate (CHEBI:133610) is conjugate base of N-isobutyrylglycine (CHEBI:70979) |
| IUPAC Names |
|---|
| [(2-methylpropanoyl)amino]acetic acid |
| N-(2-methylpropanoyl)glycine |
| Synonyms | Source |
|---|---|
| isobutyrylglycine | HMDB |
| isobutanoylglycine | ChEBI |
| N-isobutanoylglycine | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0000730 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1762789 | Reaxys |
| Citations |
|---|