EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H10O4 |
| Net Charge | 0 |
| Average Mass | 194.186 |
| Monoisotopic Mass | 194.05791 |
| SMILES | CCOC(=O)c1ccccc1C(=O)O |
| InChI | InChI=1S/C10H10O4/c1-2-14-10(13)8-6-4-3-5-7(8)9(11)12/h3-6H,2H2,1H3,(H,11,12) |
| InChIKey | YWWHKOHZGJFMIE-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | endocrine disruptor Any compound that can disrupt the functions of the endocrine (hormone) system |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| monoethyl phthalate (CHEBI:70973) has role metabolite (CHEBI:25212) |
| monoethyl phthalate (CHEBI:70973) is a ethyl ester (CHEBI:23990) |
| monoethyl phthalate (CHEBI:70973) is a phthalic acid monoester (CHEBI:132610) |
| IUPAC Name |
|---|
| 2-(ethoxycarbonyl)benzoic acid |
| Synonyms | Source |
|---|---|
| mEtP | ChEBI |
| phthalic acid monoethyl ester | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| HMDB0002120 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1956404 | Reaxys |
| CAS:2306-33-4 | ChemIDplus |
| Citations |
|---|