EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H11N3O2 |
| Net Charge | 0 |
| Average Mass | 169.184 |
| Monoisotopic Mass | 169.08513 |
| SMILES | COC(=O)C(N)Cc1cncn1 |
| InChI | InChI=1S/C7H11N3O2/c1-12-7(11)6(8)2-5-3-9-4-10-5/h3-4,6H,2,8H2,1H3,(H,9,10) |
| InChIKey | BXRMEWOQUXOLDH-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| histidine methyl ester (CHEBI:70961) has role metabolite (CHEBI:25212) |
| histidine methyl ester (CHEBI:70961) is a histidine derivative (CHEBI:24599) |
| histidine methyl ester (CHEBI:70961) is a methyl ester (CHEBI:25248) |
| histidine methyl ester (CHEBI:70961) is a α-amino acid ester (CHEBI:46874) |
| IUPAC Names |
|---|
| methyl histidinate |
| methyl 2-amino-3-(1H-imidazol-5-yl)propanoate |
| Synonym | Source |
|---|---|
| methyl histidinate | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:957974 | Reaxys |
| Citations |
|---|