EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H11N3O2 |
| Net Charge | 0 |
| Average Mass | 169.184 |
| Monoisotopic Mass | 169.08513 |
| SMILES | Cn1cnc(CC(N)C(=O)O)c1 |
| InChI | InChI=1S/C7H11N3O2/c1-10-3-5(9-4-10)2-6(8)7(11)12/h3-4,6H,2,8H2,1H3,(H,11,12) |
| InChIKey | BRMWTNUJHUMWMS-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | human urinary metabolite Any metabolite (endogenous or exogenous) found in human urine samples. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-methylhistidine (CHEBI:70958) has role human urinary metabolite (CHEBI:84087) |
| 1-methylhistidine (CHEBI:70958) is a methylhistidine (CHEBI:137682) |
| 1-methylhistidine (CHEBI:70958) is a non-proteinogenic α-amino acid (CHEBI:83925) |
| 1-methylhistidine (CHEBI:70958) is tautomer of 1-methylhistidine zwitterion (CHEBI:133608) |
| Incoming Relation(s) |
| 1-methylhistidine zwitterion (CHEBI:133608) is tautomer of 1-methylhistidine (CHEBI:70958) |
| IUPAC Names |
|---|
| 1-methylhistidine |
| 2-amino-3-(1-methyl-1H-imidazol-4-yl)propanoic acid |
| Synonym | Source |
|---|---|
| 1-methyl-DL-histidine | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:611190 | Reaxys |
| Citations |
|---|