EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:7091 - N-(5-phospho-β-D-ribosyl)anthranilic acid
| Formula | C12H16NO9P |
| Net Charge | 0 |
| Average Mass | 349.232 |
| Monoisotopic Mass | 349.05627 |
| SMILES | O=C(O)c1ccccc1N[C@@H]1O[C@H](COP(=O)(O)O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C12H16NO9P/c14-9-8(5-21-23(18,19)20)22-11(10(9)15)13-7-4-2-1-3-6(7)12(16)17/h1-4,8-11,13-15H,5H2,(H,16,17)(H2,18,19,20)/t8-,9-,10-,11-/m1/s1 |
| InChIKey | PMFMJXPRNJUYMB-GWOFURMSSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-(5-phospho-β-D-ribosyl)anthranilic acid (CHEBI:7091) has functional parent anthranilic acid (CHEBI:30754) |
| N-(5-phospho-β-D-ribosyl)anthranilic acid (CHEBI:7091) is a N-glycosyl compound (CHEBI:21731) |
| N-(5-phospho-β-D-ribosyl)anthranilic acid (CHEBI:7091) is a ribose monophosphate (CHEBI:35159) |
| N-(5-phospho-β-D-ribosyl)anthranilic acid (CHEBI:7091) is conjugate acid of N-(5-phosphonato-β-D-ribosyl)anthranilate (CHEBI:18277) |
| Incoming Relation(s) |
| N-(5-phosphonato-β-D-ribosyl)anthranilate (CHEBI:18277) is conjugate base of N-(5-phospho-β-D-ribosyl)anthranilic acid (CHEBI:7091) |
| IUPAC Name |
|---|
| N-(2-carboxyphenyl)-β-D-ribofuranosylamine 5-(dihydrogen phosphate) |
| Synonyms | Source |
|---|---|
| N-(5-Phosphoribosyl)anthranilic acid | KEGG COMPOUND |
| N-(5'-Phosphoribosyl)anthranilate | ChemIDplus |
| NPRAT | ChemIDplus |