EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H12O4 |
| Net Charge | 0 |
| Average Mass | 160.169 |
| Monoisotopic Mass | 160.07356 |
| SMILES | COC(=O)CCCCC(=O)O |
| InChI | InChI=1S/C7H12O4/c1-11-7(10)5-3-2-4-6(8)9/h2-5H2,1H3,(H,8,9) |
| InChIKey | UOBSVARXACCLLH-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | plasticiser Any compound that is used as an additive to increase the plasticity or fluidity of a substance, particularly but not exclusively to synthetic polymers. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| monomethyl adipate (CHEBI:70855) has role metabolite (CHEBI:25212) |
| monomethyl adipate (CHEBI:70855) has role plasticiser (CHEBI:79056) |
| monomethyl adipate (CHEBI:70855) is a dicarboxylic acid monoester (CHEBI:36244) |
| IUPAC Name |
|---|
| 6-methoxy-6-oxohexanoic acid |
| Synonyms | Source |
|---|---|
| methyl adipate | ChEBI |
| Monomethyl 1,6-hexanedioate | ChemIDplus |
| Adipic acid monomethyl ester | ChemIDplus |
| 1-methyl ester Hexanedioic acid | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| WO2008095614 | Patent |
| WO9843939 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1766411 | Reaxys |
| CAS:627-91-8 | ChemIDplus |
| Citations |
|---|