EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H7N3O |
| Net Charge | 0 |
| Average Mass | 125.131 |
| Monoisotopic Mass | 125.05891 |
| SMILES | COc1nccc(N)n1 |
| InChI | InChI=1S/C5H7N3O/c1-9-5-7-3-2-4(6)8-5/h2-3H,1H3,(H2,6,7,8) |
| InChIKey | DHYLZDVDOQLEAQ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-O-methylcytosine (CHEBI:70854) has functional parent cytosine (CHEBI:16040) |
| 2-O-methylcytosine (CHEBI:70854) has role metabolite (CHEBI:25212) |
| 2-O-methylcytosine (CHEBI:70854) is a aminopyrimidine (CHEBI:38338) |
| 2-O-methylcytosine (CHEBI:70854) is a aromatic ether (CHEBI:35618) |
| 2-O-methylcytosine (CHEBI:70854) is a methylcytosine (CHEBI:134207) |
| IUPAC Name |
|---|
| 2-methoxypyrimidin-4-amine |
| Synonyms | Source |
|---|---|
| 4-Amino-2-methoxypyrimidine | ChemIDplus |
| O-2-Methylcytosine | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| HMDB0004339 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:118041 | Reaxys |
| CAS:3289-47-2 | ChemIDplus |
| Citations |
|---|