EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H37NO2 |
| Net Charge | 0 |
| Average Mass | 287.488 |
| Monoisotopic Mass | 287.28243 |
| SMILES | CC(C)CCCCCCCCCCC[C@@H](O)[C@@H](N)CO |
| InChI | InChI=1S/C17H37NO2/c1-15(2)12-10-8-6-4-3-5-7-9-11-13-17(20)16(18)14-19/h15-17,19-20H,3-14,18H2,1-2H3/t16-,17+/m0/s1 |
| InChIKey | VFYHIOGWELBGIK-DLBZAZTESA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 15-methylhexadecasphinganine (CHEBI:70852) is a aminodiol (CHEBI:22501) |
| 15-methylhexadecasphinganine (CHEBI:70852) is a sphingoid (CHEBI:35785) |
| 15-methylhexadecasphinganine (CHEBI:70852) is conjugate base of 15-methylhexadecasphinganine(1+) (CHEBI:70829) |
| Incoming Relation(s) |
| N-acyl-15-methylhexadecasphinganine (CHEBI:70845) has functional parent 15-methylhexadecasphinganine (CHEBI:70852) |
| N-acyl-15-methylhexadecasphinganine-1-phosphocholine (CHEBI:82899) has functional parent 15-methylhexadecasphinganine (CHEBI:70852) |
| N-acyl-15-methylhexadecasphinganine-1-phosphoethanolamine (CHEBI:83765) has functional parent 15-methylhexadecasphinganine (CHEBI:70852) |
| N-acyl-15-methylhexadecasphinganine-1-phosphoethanolamine zwitterion (CHEBI:82915) has functional parent 15-methylhexadecasphinganine (CHEBI:70852) |
| 15-methylhexadecasphinganine 1-phosphate (CHEBI:71059) has functional parent 15-methylhexadecasphinganine (CHEBI:70852) |
| β-D-glucosyl-(1↔1')-N-tricosanoyl-15-methylhexadecasphinganine (CHEBI:132787) has functional parent 15-methylhexadecasphinganine (CHEBI:70852) |
| 15-methylhexadecasphinganine(1+) (CHEBI:70829) is conjugate acid of 15-methylhexadecasphinganine (CHEBI:70852) |
| Synonym | Source |
|---|---|
| 15-methylhexadecadihydrosphingosine | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:18599379 | Reaxys |