EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H34O2 |
| Net Charge | 0 |
| Average Mass | 270.457 |
| Monoisotopic Mass | 270.25588 |
| SMILES | CC(C)CCCCCCCCCCCCCC(=O)O |
| InChI | InChI=1S/C17H34O2/c1-16(2)14-12-10-8-6-4-3-5-7-9-11-13-15-17(18)19/h16H,3-15H2,1-2H3,(H,18,19) |
| InChIKey | IIUXHTGBZYEGHI-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| isoheptadecanoic acid (CHEBI:70850) is a branched-chain saturated fatty acid (CHEBI:39417) |
| isoheptadecanoic acid (CHEBI:70850) is a long-chain fatty acid (CHEBI:15904) |
| isoheptadecanoic acid (CHEBI:70850) is a methyl-branched fatty acid (CHEBI:62499) |
| isoheptadecanoic acid (CHEBI:70850) is conjugate acid of isoheptadecanoate (CHEBI:70838) |
| Incoming Relation(s) |
| isoheptadecanoyl-CoA (CHEBI:71540) has functional parent isoheptadecanoic acid (CHEBI:70850) |
| thermozeaxanthin-17 (CHEBI:80207) has functional parent isoheptadecanoic acid (CHEBI:70850) |
| ω-hydroxy-15-methylpalmitic acid (CHEBI:84939) has functional parent isoheptadecanoic acid (CHEBI:70850) |
| isoheptadecanoate (CHEBI:70838) is conjugate base of isoheptadecanoic acid (CHEBI:70850) |
| IUPAC Name |
|---|
| 15-methylhexadecanoic acid |
| Synonyms | Source |
|---|---|
| 15-methyl hexadecanoic acid | ChemIDplus |
| 15-methyl palmitic acid | LIPID MAPS |
| 15-methylpalmitic acid | ChEBI |
| C17:0 (iso) | ChEBI |
| i-17:0 | ChEBI |
| i17:0 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| EP2143705 | Patent |
| LMFA01020012 | LIPID MAPS |
| US2008214666 | Patent |
| US7109364 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1781002 | Reaxys |
| CAS:1603-03-8 | ChemIDplus |
| Citations |
|---|