EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H35NO2 |
| Net Charge | 0 |
| Average Mass | 285.472 |
| Monoisotopic Mass | 285.26678 |
| SMILES | CC(C)CCCCCCCCCCCC(=O)[C@@H](N)CO |
| InChI | InChI=1S/C17H35NO2/c1-15(2)12-10-8-6-4-3-5-7-9-11-13-17(20)16(18)14-19/h15-16,19H,3-14,18H2,1-2H3/t16-/m0/s1 |
| InChIKey | RGDAORVPVAQJHT-INIZCTEOSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-dehydro-15-methylhexadecasphinganine (CHEBI:70843) is a amino alcohol (CHEBI:22478) |
| 3-dehydro-15-methylhexadecasphinganine (CHEBI:70843) is a ketone (CHEBI:17087) |
| 3-dehydro-15-methylhexadecasphinganine (CHEBI:70843) is a sphingoid (CHEBI:35785) |
| 3-dehydro-15-methylhexadecasphinganine (CHEBI:70843) is conjugate base of 3-dehydro-15-methylhexadecasphinganine(1+) (CHEBI:70828) |
| Incoming Relation(s) |
| 3-dehydro-15-methylhexadecasphinganine(1+) (CHEBI:70828) is conjugate acid of 3-dehydro-15-methylhexadecasphinganine (CHEBI:70843) |
| IUPAC Name |
|---|
| (2S)-2-amino-1-hydroxy-15-methylhexadecan-3-one |
| Synonyms | Source |
|---|---|
| 3-oxo-15-methylhexadecasphinganine | ChEBI |
| 3-keto-15-methylhexadecasphinganine | ChEBI |