EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H13NO3 |
| Net Charge | 0 |
| Average Mass | 159.185 |
| Monoisotopic Mass | 159.08954 |
| SMILES | COC(=O)C1CNC(CO)C1 |
| InChI | InChI=1S/C7H13NO3/c1-11-7(10)5-2-6(4-9)8-3-5/h5-6,8-9H,2-4H2,1H3 |
| InChIKey | BSILTUUPJBINLI-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| methyl 5-(hydroxymethyl)pyrrolidine-3-carboxylate (CHEBI:70830) has role metabolite (CHEBI:25212) |
| methyl 5-(hydroxymethyl)pyrrolidine-3-carboxylate (CHEBI:70830) is a methyl ester (CHEBI:25248) |
| methyl 5-(hydroxymethyl)pyrrolidine-3-carboxylate (CHEBI:70830) is a primary alcohol (CHEBI:15734) |
| methyl 5-(hydroxymethyl)pyrrolidine-3-carboxylate (CHEBI:70830) is a pyrrolidines (CHEBI:38260) |
| methyl 5-(hydroxymethyl)pyrrolidine-3-carboxylate (CHEBI:70830) is a secondary amino compound (CHEBI:50995) |
| methyl 5-(hydroxymethyl)pyrrolidine-3-carboxylate (CHEBI:70830) is a β-amino acid ester (CHEBI:85139) |
| IUPAC Name |
|---|
| methyl 5-(hydroxymethyl)pyrrolidine-3-carboxylate |
| Citations |
|---|