EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H9NO4 |
| Net Charge | 0 |
| Average Mass | 195.174 |
| Monoisotopic Mass | 195.05316 |
| SMILES | O=C(O)CNC(=O)c1cccc(O)c1 |
| InChI | InChI=1S/C9H9NO4/c11-7-3-1-2-6(4-7)9(14)10-5-8(12)13/h1-4,11H,5H2,(H,10,14)(H,12,13) |
| InChIKey | XDOFWFNMYJRHEW-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| m-hydroxyhippuric acid (CHEBI:70824) has functional parent N-benzoylglycine (CHEBI:18089) |
| m-hydroxyhippuric acid (CHEBI:70824) has role metabolite (CHEBI:25212) |
| m-hydroxyhippuric acid (CHEBI:70824) is a N-acylglycine (CHEBI:16180) |
| m-hydroxyhippuric acid (CHEBI:70824) is a phenols (CHEBI:33853) |
| m-hydroxyhippuric acid (CHEBI:70824) is conjugate acid of m-hydroxyhippurate (CHEBI:133607) |
| Incoming Relation(s) |
| m-hydroxyhippurate (CHEBI:133607) is conjugate base of m-hydroxyhippuric acid (CHEBI:70824) |
| IUPAC Names |
|---|
| [(3-hydroxybenzoyl)amino]acetic acid |
| N-(3-hydroxybenzoyl)glycine |
| Synonyms | Source |
|---|---|
| 2-[(3-hydroxyphenyl)formamido]acetic acid | DrugBank |
| 3-hydroxybenzoylglycine | HMDB |
| 3-hydroxyhippuric acid | HMDB |
| Manual Xrefs | Databases |
|---|---|
| 3XH | PDBeChem |
| DB07069 | DrugBank |
| HMDB0006116 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2110259 | Reaxys |
| CAS:1637-75-8 | ChemIDplus |
| Citations |
|---|