EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | (C5H8)n.C6H13O9P |
| Net Charge | 0 |
| Average Mass | 328.254 |
| Monoisotopic Mass | 328.09232 |
| SMILES | [H]C/C(C)=C/COP(=O)(O)OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C11H21O9P/c1-6(2)3-4-18-21(16,17)20-11-10(15)9(14)8(13)7(5-12)19-11/h3,7-15H,4-5H2,1-2H3,(H,16,17)/t7-,8-,9+,10-,11?/m1/s1 |
| InChIKey | BPNOOARYSOFWDX-YBTJCZCISA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| polyprenyl D-glucosyl phosphate (CHEBI:70823) is a polyprenyl glucosyl phosphate (CHEBI:17223) |
| polyprenyl D-glucosyl phosphate (CHEBI:70823) is conjugate acid of polyprenyl D-glucosyl phosphate(1−) (CHEBI:68853) |
| Incoming Relation(s) |
| polyprenyl D-glucosyl phosphate(1−) (CHEBI:68853) is conjugate base of polyprenyl D-glucosyl phosphate (CHEBI:70823) |
| Synonyms | Source |
|---|---|
| polyprenyl glucosyl phosphate | ChEBI |
| polyprenylphosphate-D-glucose | ChEBI |