EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H23NO4 |
| Net Charge | 0 |
| Average Mass | 245.319 |
| Monoisotopic Mass | 245.16271 |
| SMILES | CC(C)CC(=O)O[C@H](CC(=O)[O-])C[N+](C)(C)C |
| InChI | InChI=1S/C12H23NO4/c1-9(2)6-12(16)17-10(7-11(14)15)8-13(3,4)5/h9-10H,6-8H2,1-5H3/t10-/m1/s1 |
| InChIKey | IGQBPDJNUXPEMT-SNVBAGLBSA-N |
| Roles Classification |
|---|
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| Application: | bone density conservation agent An agent that inhibits bone resorption and/or favor bone mineralization and bone regeneration. Used to heal bone fractures and to treat bone diseases such as osteopenia and osteoporosis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| isovaleryl-L-carnitine (CHEBI:70819) has role bone density conservation agent (CHEBI:50646) |
| isovaleryl-L-carnitine (CHEBI:70819) is a O-isovalerylcarnitine (CHEBI:73025) |
| isovaleryl-L-carnitine (CHEBI:70819) is a methyl-branched fatty acyl-L-carnitine (CHEBI:133447) |
| IUPAC Name |
|---|
| (3R)-3-[(3-methylbutanoyl)oxy]-4-(trimethylazaniumyl)butanoate |
| UniProt Name | Source |
|---|---|
| O-3-methylbutanoyl-(R)-carnitine | UniProt |
| Manual Xrefs | Databases |
|---|---|
| HMDB0000688 | HMDB |
| US6906102 | Patent |
| US7084174 | Patent |
| US2010189704 | Patent |
| WO0249639 | Patent |
| EP1351676 | Patent |
| US2005143458 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5946880 | Reaxys |
| CAS:31023-24-2 | ChemIDplus |
| Citations |
|---|