EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H10O4 |
| Net Charge | 0 |
| Average Mass | 182.175 |
| Monoisotopic Mass | 182.05791 |
| SMILES | COc1ccc(CC(=O)O)cc1O |
| InChI | InChI=1S/C9H10O4/c1-13-8-3-2-6(4-7(8)10)5-9(11)12/h2-4,10H,5H2,1H3,(H,11,12) |
| InChIKey | BWXLCOBSWMQCGP-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| isohomovanillic acid (CHEBI:70818) has functional parent (3,4-dihydroxyphenyl)acetic acid (CHEBI:41941) |
| isohomovanillic acid (CHEBI:70818) has role metabolite (CHEBI:25212) |
| isohomovanillic acid (CHEBI:70818) is a aromatic ether (CHEBI:35618) |
| isohomovanillic acid (CHEBI:70818) is a phenols (CHEBI:33853) |
| isohomovanillic acid (CHEBI:70818) is a phenylacetic acids (CHEBI:25978) |
| IUPAC Name |
|---|
| (3-hydroxy-4-methoxyphenyl)acetic acid |
| Synonym | Source |
|---|---|
| Homoisovanillic acid | HMDB |
| Manual Xrefs | Databases |
|---|---|
| HMDB0000333 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1244106 | Reaxys |
| CAS:1131-94-8 | ChemIDplus |
| Citations |
|---|