EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H48O5 |
| Net Charge | 0 |
| Average Mass | 488.709 |
| Monoisotopic Mass | 488.35017 |
| SMILES | [H][C@]12CC=C3[C@]4([H])CC(C)(C)[C@@H](O)C[C@]4(C(=O)O)[C@H](O)C[C@@]3(C)[C@]1(C)CC[C@@]1([H])C(C)(C)[C@@H](O)CC[C@]21C |
| InChI | InChI=1S/C30H48O5/c1-25(2)14-18-17-8-9-20-27(5)12-11-21(31)26(3,4)19(27)10-13-28(20,6)29(17,7)15-23(33)30(18,24(34)35)16-22(25)32/h8,18-23,31-33H,9-16H2,1-7H3,(H,34,35)/t18-,19-,20+,21-,22-,23+,27-,28+,29+,30+/m0/s1 |
| InChIKey | CFKXWTNHIJAFNL-OOURDANISA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| acacic acid (CHEBI:70803) has parent hydride oleanane (CHEBI:36481) |
| acacic acid (CHEBI:70803) has role metabolite (CHEBI:25212) |
| acacic acid (CHEBI:70803) is a hydroxy monocarboxylic acid (CHEBI:35868) |
| acacic acid (CHEBI:70803) is a pentacyclic triterpenoid (CHEBI:25872) |
| Incoming Relation(s) |
| albizoside A (CHEBI:65379) has functional parent acacic acid (CHEBI:70803) |
| albizoside B (CHEBI:65380) has functional parent acacic acid (CHEBI:70803) |
| albizoside C (CHEBI:65381) has functional parent acacic acid (CHEBI:70803) |
| IUPAC Name |
|---|
| (3β,16α,21β)-3,16,21-trihydroxyolean-12-en-28-oic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2229601 | Reaxys |
| CAS:1962-14-7 | ChemIDplus |
| Citations |
|---|